cas: 41351-30-8 — see every product listed under this CAS number, including other names
2,4-Dimethoxy-4'-hydroxybenzophenone, >98.0%(T) (CAS 41351-30-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2707-5G |
| cas | 41351-30-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 197.02 Pln | |
| TCI | 25g | 851.02 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
(2,4-dimethoxyphenyl)-(4-hydroxyphenyl)methanone (CAS 41351-30-8) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: (2,4-dimethoxyphenyl)-(4-hydroxyphenyl)methanone. InChIKey: QEHRETCJMLQPCR-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | (2,4-dimethoxyphenyl)-(4-hydroxyphenyl)methanone |
| InChIKey | QEHRETCJMLQPCR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)C2=CC=C(C=C2)O)OC |
Computed by PubChem (NCBI)