CAS 1610527-49-5 appears in our catalog under these names: Vortioxetine Impurity 32, (2,4–Dimethylphenyl)(2–nitrophenyl)sulfane, (2,4-Dimethylphenyl)(2-nitrophenyl)sulfane, 98%, 98%, (2,4-Dimethylphenyl)(2-nitrophenyl)sulfane, 98%. Offered by: Chemat Brand, GLPBio, Chemat, Fluorochem. Available pack sizes: on request, 1g, 5g, 25g, 100g, 10g, 50g.
2,4-dimethyl-1-(2-nitrophenyl)sulfanylbenzene (CAS 1610527-49-5) is a chemical compound with the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. IUPAC name: 2,4-dimethyl-1-(2-nitrophenyl)sulfanylbenzene. InChIKey: SHBWPKLGXVSPIP-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2S |
|---|---|
| Molecular weight | 259.33 g/mol |
| IUPAC name | 2,4-dimethyl-1-(2-nitrophenyl)sulfanylbenzene |
| InChIKey | SHBWPKLGXVSPIP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)SC2=CC=CC=C2[N+](=O)[O-])C |
Computed by PubChem (NCBI)