CAS 1428139-83-6 is the registry number for 7-(5-Methyl-2-thienyl)-7,8-dihydroquinoline-2,5(1h,6h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7-(5-methylthiophen-2-yl)-1,6,7,8-tetrahydroquinoline-2,5-dione (CAS 1428139-83-6) is a chemical compound with the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. IUPAC name: 7-(5-methylthiophen-2-yl)-1,6,7,8-tetrahydroquinoline-2,5-dione. InChIKey: LUSNYAGRXBGBMX-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2S |
|---|---|
| Molecular weight | 259.33 g/mol |
| IUPAC name | 7-(5-methylthiophen-2-yl)-1,6,7,8-tetrahydroquinoline-2,5-dione |
| InChIKey | LUSNYAGRXBGBMX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C2CC3=C(C=CC(=O)N3)C(=O)C2 |
Computed by PubChem (NCBI)