Products 852388-70-6

CAS 852388-70-6 appears in our catalog under these names: 2-[(2,4-Dimethylphenyl)thio]nicotinic acid, 95%, 2-((2,4-Dimethylphenyl)sulfanyl)pyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(2,4-dimethylphenyl)sulfanylpyridine-3-carboxylic acid (CAS 852388-70-6) is a chemical compound with the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. IUPAC name: 2-(2,4-dimethylphenyl)sulfanylpyridine-3-carboxylic acid. InChIKey: NCGXUBLFJFDNMA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13NO2S
Molecular weight259.33 g/mol
IUPAC name2-(2,4-dimethylphenyl)sulfanylpyridine-3-carboxylic acid
InChIKeyNCGXUBLFJFDNMA-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)SC2=C(C=CC=N2)C(=O)O)C

Computed by PubChem (NCBI)