CAS 1019584-14-5 appears in our catalog under these names: 7-(Phenylsulfanyl)-2,3-dihydro-1,4-benzodioxin-6-amine, 95%, 7-(Phenylsulfanyl)-2,3-dihydro-1,4-benzodioxin-6-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
6-phenylsulfanyl-2,3-dihydro-1,4-benzodioxin-7-amine (CAS 1019584-14-5) is a chemical compound with the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. IUPAC name: 6-phenylsulfanyl-2,3-dihydro-1,4-benzodioxin-7-amine. InChIKey: OXUHLCGCWHQHQW-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2S |
|---|---|
| Molecular weight | 259.33 g/mol |
| IUPAC name | 6-phenylsulfanyl-2,3-dihydro-1,4-benzodioxin-7-amine |
| InChIKey | OXUHLCGCWHQHQW-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)SC3=CC=CC=C3)N |
Computed by PubChem (NCBI)