CAS 361336-73-4 appears in our catalog under these names: 5-Amino-2-phenylsulfanyl-benzoic acid methyl ester, 95%, Methyl 5-amino-2-(phenylthio)benzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
Methyl 5-amino-2-phenylsulfanylbenzoate (CAS 361336-73-4) is a chemical compound with the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. IUPAC name: methyl 5-amino-2-phenylsulfanylbenzoate. InChIKey: KXTIPIDMAUQQJF-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2S |
|---|---|
| Molecular weight | 259.33 g/mol |
| IUPAC name | methyl 5-amino-2-phenylsulfanylbenzoate |
| InChIKey | KXTIPIDMAUQQJF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)N)SC2=CC=CC=C2 |
Computed by PubChem (NCBI)