cas: 107099-99-0 — see every product listed under this CAS number, including other names
(2,5-Dimethoxyphenyl)boronic acid, 98%, 98% (CAS 107099-99-0) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FZ5-1kg |
| cas | 107099-99-0 |
| size | 1kg |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 3520.40 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 100g | 482.00 Pln | |
| Chemat | 500g | 2217.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,5-dimethoxyphenyl)boronic acid (CAS 107099-99-0) is a chemical compound with the molecular formula C8H11BO4 and a molecular weight of 181.98 g/mol. IUPAC name: (2,5-dimethoxyphenyl)boronic acid. InChIKey: QOZLFNQLIKOGDR-UHFFFAOYSA-N.
| Molecular formula | C8H11BO4 |
|---|---|
| Molecular weight | 181.98 g/mol |
| IUPAC name | (2,5-dimethoxyphenyl)boronic acid |
| InChIKey | QOZLFNQLIKOGDR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC)OC)(O)O |
Computed by PubChem (NCBI)