CAS 107099-99-0 appears in our catalog under these names: 2,5–Dimethoxyphenylboronic acid(contains varying amounts of Anhydride), 2,5-Dimethoxyphenylboronic acid/ 95+%, 2,5-Dimethoxybenzeneboronic acid, 98% , 2,5-Dimethoxyphenylboronic Acid (contains varying amounts of Anhydride), (2,5-Dimethoxyphenyl)boronic acid 97%. Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 100g, 25g, 500g, 5g, 1g, 1000g, 1kg, 10g.
(2,5-dimethoxyphenyl)boronic acid (CAS 107099-99-0) is a chemical compound with the molecular formula C8H11BO4 and a molecular weight of 181.98 g/mol. IUPAC name: (2,5-dimethoxyphenyl)boronic acid. InChIKey: QOZLFNQLIKOGDR-UHFFFAOYSA-N.
| Molecular formula | C8H11BO4 |
|---|---|
| Molecular weight | 181.98 g/mol |
| IUPAC name | (2,5-dimethoxyphenyl)boronic acid |
| InChIKey | QOZLFNQLIKOGDR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC)OC)(O)O |
Computed by PubChem (NCBI)