cas: 1003043-46-6 — see every product listed under this CAS number, including other names
(2,6-Diethoxypyridin-3-yl)boronic acid, 95+% (CAS 1003043-46-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A217131-25g |
| cas | 1003043-46-6 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 19873.42 Pln | |
| AmBeed | 5g | 5994.10 Pln | |
| AmBeed | 10g | 10140.97 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2,6-diethoxy-3-pyridinyl)boronic acid (CAS 1003043-46-6) is a chemical compound with the molecular formula C9H14BNO4 and a molecular weight of 211.03 g/mol. IUPAC name: (2,6-diethoxy-3-pyridinyl)boronic acid. InChIKey: HTELBRAIBMTDOF-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO4 |
|---|---|
| Molecular weight | 211.03 g/mol |
| IUPAC name | (2,6-diethoxy-3-pyridinyl)boronic acid |
| InChIKey | HTELBRAIBMTDOF-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)OCC)OCC)(O)O |
Computed by PubChem (NCBI)