CAS 1104637-48-0 is the registry number for trans–1–Butenylboronic acid MIDA ester. Offered by: GLPBio. Available pack sizes: 1g.
2-[(E)-but-1-enyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1104637-48-0) is a chemical compound with the molecular formula C9H14BNO4 and a molecular weight of 211.03 g/mol. IUPAC name: 2-[(E)-but-1-enyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: VYHBJTPGBOGZLT-SNAWJCMRSA-N.
| Molecular formula | C9H14BNO4 |
|---|---|
| Molecular weight | 211.03 g/mol |
| IUPAC name | 2-[(E)-but-1-enyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | VYHBJTPGBOGZLT-SNAWJCMRSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)/C=C/CC |
Computed by PubChem (NCBI)