cas: 1310384-19-0 — see every product listed under this CAS number, including other names
(2–Methoxy–6–(trifluoromethyl)phenyl)boronic acid (CAS 1310384-19-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF53183-100mg |
| cas | 1310384-19-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 625.12 Pln | |
| GLPBio | 1g | 1247.63 Pln | |
| GLPBio | 250mg | 788.94 Pln | |
| GLPBio | 5g | 3868.71 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[2-methoxy-6-(trifluoromethyl)phenyl]boronic acid (CAS 1310384-19-0) is a chemical compound with the molecular formula C8H8BF3O3 and a molecular weight of 219.96 g/mol. IUPAC name: [2-methoxy-6-(trifluoromethyl)phenyl]boronic acid. InChIKey: NCTLQYZNASYUIW-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O3 |
|---|---|
| Molecular weight | 219.96 g/mol |
| IUPAC name | [2-methoxy-6-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | NCTLQYZNASYUIW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1OC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)