CAS 871125-69-8 is the registry number for 3–Ethoxy–2,4,6–trifluorophenylboronic acid. Offered by: GLPBio. Available pack sizes: 1g.
(3-ethoxy-2,4,6-trifluorophenyl)boronic acid (CAS 871125-69-8) is a chemical compound with the molecular formula C8H8BF3O3 and a molecular weight of 219.96 g/mol. IUPAC name: (3-ethoxy-2,4,6-trifluorophenyl)boronic acid. InChIKey: SGJHUHAGELVQDV-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O3 |
|---|---|
| Molecular weight | 219.96 g/mol |
| IUPAC name | (3-ethoxy-2,4,6-trifluorophenyl)boronic acid |
| InChIKey | SGJHUHAGELVQDV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1F)F)OCC)F)(O)O |
Computed by PubChem (NCBI)