CAS 149507-36-8 appears in our catalog under these names: 4-Methoxy-3-(trifluoromethyl)benzeneboronic acid, 98% , 4-Methoxy-3-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride), (4-Methoxy-3-(trifluoromethyl)phenyl)boronic acid, 98%, 98%, (4-Methoxy-3-(trifluoromethyl)phenyl)boronic acid, 95%, (4-Methoxy-3-(trifluoromethyl)phenyl)boronic acid, 98%. Offered by: Thermo Scientific (Alfa Aesar), TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 200mg, 100mg, 250mg, 5g, 10g.
[4-methoxy-3-(trifluoromethyl)phenyl]boronic acid (CAS 149507-36-8) is a chemical compound with the molecular formula C8H8BF3O3 and a molecular weight of 219.96 g/mol. IUPAC name: [4-methoxy-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: BUSMBMGODABSIN-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O3 |
|---|---|
| Molecular weight | 219.96 g/mol |
| IUPAC name | [4-methoxy-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | BUSMBMGODABSIN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)