Products 871332-97-7
CAS 871332-97-7 appears in our catalog under these names: 3-Methoxy-5-(trifluoromethyl)phenylboronic acid, 97%, 3-Methoxy-5-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride), 3-Methoxy-5-(trifluoromethyl)phenylboronic acid, 95%. Offered by: Thermo Scientific (Acros), Chemat, TCI, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 50g.
[3-methoxy-5-(trifluoromethyl)phenyl]boronic acid (CAS 871332-97-7) is a chemical compound with the molecular formula C8H8BF3O3 and a molecular weight of 219.96 g/mol. IUPAC name: [3-methoxy-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: GKEMDZIGTOAZRK-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O3 |
|---|---|
| Molecular weight | 219.96 g/mol |
| IUPAC name | [3-methoxy-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | GKEMDZIGTOAZRK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Methoxy-5-(trifluoromethyl)phenylboronic acid, [3-methoxy-5-(trifluoromethyl)phenyl]boronic acid, (3-methoxy-5-(trifluoromethyl)phenyl)boronic acid, Boronic acid, [3-methoxy-5-(trifluoromethyl)phenyl]-, 3-Methoxy-5-trifluoromethylbenzeneboronic acid, 3-Methoxy-5-(trifluoromethyl)phenylboronicacid