CAS 339538-60-2 is the registry number for (2-(Isopropoxycarbonyl)phenyl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 5g.
(2-propan-2-yloxycarbonylphenyl)boronic acid (CAS 339538-60-2) is a chemical compound with the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. IUPAC name: (2-propan-2-yloxycarbonylphenyl)boronic acid. InChIKey: UHSGPEFNAZQASO-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | (2-propan-2-yloxycarbonylphenyl)boronic acid |
| InChIKey | UHSGPEFNAZQASO-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C(=O)OC(C)C)(O)O |
Computed by PubChem (NCBI)