CAS 850568-78-4 appears in our catalog under these names: (3-Propoxycarbonyl)phenylboronic acid, 97%, (3–Propoxycarbonyl)phenylboronic acid, 3-Propoxycarbonylphenylboronic acid 98%, 3-(Propoxycarbonyl)phenylboronic acid, 98%, 98%, 3-Propoxycarbonylphenylboronic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 500g, 1g.
(3-propoxycarbonylphenyl)boronic acid (CAS 850568-78-4) is a chemical compound with the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. IUPAC name: (3-propoxycarbonylphenyl)boronic acid. InChIKey: BSCFVVVAJINDLA-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | (3-propoxycarbonylphenyl)boronic acid |
| InChIKey | BSCFVVVAJINDLA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)OCCC)(O)O |
Computed by PubChem (NCBI)