CAS 2096339-62-5 appears in our catalog under these names: 4-(Ethoxycarbonyl)-2-methylphenylboronic acid, 96%, (4–(Ethoxycarbonyl)–2–methylphenyl)boronic acid, (4-(Ethoxycarbonyl)-2-methylphenyl)boronic acid 97%, (4-(Ethoxycarbonyl)-2-methylphenyl)boronic acid, 97%, 97%, 4-(Ethoxycarbonyl)-2-methylphenylboronic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
(4-ethoxycarbonyl-2-methylphenyl)boronic acid (CAS 2096339-62-5) is a chemical compound with the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. IUPAC name: (4-ethoxycarbonyl-2-methylphenyl)boronic acid. InChIKey: LWBVSJUFMSDTAU-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | (4-ethoxycarbonyl-2-methylphenyl)boronic acid |
| InChIKey | LWBVSJUFMSDTAU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OCC)C)(O)O |
Computed by PubChem (NCBI)