CAS 850568-44-4 appears in our catalog under these names: 4-(2-Methoxycarbonylethyl)phenylboronic acid, 97%, 4-(2-Methoxycarbonylethyl)phenylboronic acid, 95%, 4-(2-Methoxycarbonylethyl)phenylboronic acid, 98%, (4-(3-Methoxy-3-oxopropyl)phenyl)boronic acid, 98%, 98%, (4-(3-Methoxy-3-oxopropyl)phenyl)boronic acid, 98.72%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, 100mg, 500 mg, 1 g, 100 mg, 250 mg.
[4-(3-methoxy-3-oxopropyl)phenyl]boronic acid (CAS 850568-44-4) is a chemical compound with the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. IUPAC name: [4-(3-methoxy-3-oxopropyl)phenyl]boronic acid. InChIKey: XRKIHUXCUIFHAS-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | [4-(3-methoxy-3-oxopropyl)phenyl]boronic acid |
| InChIKey | XRKIHUXCUIFHAS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CCC(=O)OC)(O)O |
Computed by PubChem (NCBI)