CAS 850568-50-2 is the registry number for 3-(2-Methyl-1,3-dioxolan-2-yl)phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[3-(2-methyl-1,3-dioxolan-2-yl)phenyl]boronic acid (CAS 850568-50-2) is a chemical compound with the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. IUPAC name: [3-(2-methyl-1,3-dioxolan-2-yl)phenyl]boronic acid. InChIKey: NSDRSKQWUQJUAE-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | [3-(2-methyl-1,3-dioxolan-2-yl)phenyl]boronic acid |
| InChIKey | NSDRSKQWUQJUAE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2(OCCO2)C)(O)O |
Computed by PubChem (NCBI)