(2-(Isopropoxycarbonyl)phenyl)boronic acid, 95%
cas: 339538-60-2 — see every product listed under this CAS number, including other names
(2-(Isopropoxycarbonyl)phenyl)boronic acid, 95% (CAS 339538-60-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1832767-250mg |
| cas | 339538-60-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 570.62 Pln | |
| Ambeed | 1g | 1393.88 Pln | |
| Ambeed | 5g | 4853.75 Pln | |
| Chemat | 250mg | 410.00 Pln | |
| Chemat | 1g | 995.60 Pln | |
| Chemat | 5g | 3414.80 Pln | |
| BLDpharm | 250mg | 558.72 Pln | |
| BLDpharm | 1g | 1369.54 Pln | |
| BLDpharm | 5g | 4762.79 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2-propan-2-yloxycarbonylphenyl)boronic acid (CAS 339538-60-2) is a chemical compound with the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. IUPAC name: (2-propan-2-yloxycarbonylphenyl)boronic acid. InChIKey: UHSGPEFNAZQASO-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | (2-propan-2-yloxycarbonylphenyl)boronic acid |
| InChIKey | UHSGPEFNAZQASO-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C(=O)OC(C)C)(O)O |
Computed by PubChem (NCBI)