cas: 874459-85-5 — see every product listed under this CAS number, including other names
(2-(Methylcarbamoyl)phenyl)boronic acid, 96% (CAS 874459-85-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F692515-100MG |
| cas | 874459-85-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 393.63 Pln | |
| Fluorochem | 250mg | 627.92 Pln | |
| Fluorochem | 1g | 1351.63 Pln | |
| Fluorochem | 5g | 4267.27 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
[2-(methylcarbamoyl)phenyl]boronic acid (CAS 874459-85-5) is a chemical compound with the molecular formula C8H10BNO3 and a molecular weight of 178.98 g/mol. IUPAC name: [2-(methylcarbamoyl)phenyl]boronic acid. InChIKey: AXWDCOSDMJAMOB-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO3 |
|---|---|
| Molecular weight | 178.98 g/mol |
| IUPAC name | [2-(methylcarbamoyl)phenyl]boronic acid |
| InChIKey | AXWDCOSDMJAMOB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C(=O)NC)(O)O |
Computed by PubChem (NCBI)