CAS 1308264-92-7 is the registry number for (E)–(4–(1–(Hydroxyimino)ethyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]boronic acid (CAS 1308264-92-7) is a chemical compound with the molecular formula C8H10BNO3 and a molecular weight of 178.98 g/mol. IUPAC name: [4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]boronic acid. InChIKey: IXSCFSAPALJOFA-UXBLZVDNSA-N.
| Molecular formula | C8H10BNO3 |
|---|---|
| Molecular weight | 178.98 g/mol |
| IUPAC name | [4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]boronic acid |
| InChIKey | IXSCFSAPALJOFA-UXBLZVDNSA-N |
| SMILES | B(C1=CC=C(C=C1)/C(=N/O)/C)(O)O |
Computed by PubChem (NCBI)