CAS 121177-82-0 appears in our catalog under these names: 4-(Methylcarbamoyl)phenylboronic Acid (contains varying amounts of Anhydride), (4-(Methylcarbamoyl)phenyl)boronic acid, 4-(N-Methylaminocarbonyl)phenylboronic acid 95%, 4-(N-Methylaminocarbonyl)phenylboronic acid, 98%, 98%, 4-(N-Methylaminocarbonyl)phenylboronic acid, 95%. Offered by: TCI, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g.
[4-(methylcarbamoyl)phenyl]boronic acid (CAS 121177-82-0) is a chemical compound with the molecular formula C8H10BNO3 and a molecular weight of 178.98 g/mol. IUPAC name: [4-(methylcarbamoyl)phenyl]boronic acid. InChIKey: UWKSYZHFTGONHY-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO3 |
|---|---|
| Molecular weight | 178.98 g/mol |
| IUPAC name | [4-(methylcarbamoyl)phenyl]boronic acid |
| InChIKey | UWKSYZHFTGONHY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC)(O)O |
Computed by PubChem (NCBI)