CAS 101251-09-6 appears in our catalog under these names: 4–Acetamidophenylboronic acid(contains varying amounts of Anhydride), 4-Acetamidophenylboronic acid/ 95+%, 4-Acetamidobenzeneboronic acid, 96% , 4-Acetamidophenyl boronic acid, 4-Acetamidophenylboronic Acid (contains varying amounts of Anhydride). Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 25g, 5g, 1g, 100g, 50g, 10g, 500g, 250mg.
(4-acetamidophenyl)boronic acid (CAS 101251-09-6) is a chemical compound with the molecular formula C8H10BNO3 and a molecular weight of 178.98 g/mol. IUPAC name: (4-acetamidophenyl)boronic acid. InChIKey: VYEWTHXZHHATTA-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO3 |
|---|---|
| Molecular weight | 178.98 g/mol |
| IUPAC name | (4-acetamidophenyl)boronic acid |
| InChIKey | VYEWTHXZHHATTA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NC(=O)C)(O)O |
Computed by PubChem (NCBI)