CAS 2247432-84-2 is the registry number for (1-Cyclopropyl-2-oxo-1,2-dihydropyridin-4-yl)boronic acid, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 100mg.
(1-cyclopropyl-2-oxo-4-pyridinyl)boronic acid (CAS 2247432-84-2) is a chemical compound with the molecular formula C8H10BNO3 and a molecular weight of 178.98 g/mol. IUPAC name: (1-cyclopropyl-2-oxo-4-pyridinyl)boronic acid. InChIKey: XHUYVFQDMFHXEE-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO3 |
|---|---|
| Molecular weight | 178.98 g/mol |
| IUPAC name | (1-cyclopropyl-2-oxo-4-pyridinyl)boronic acid |
| InChIKey | XHUYVFQDMFHXEE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=O)N(C=C1)C2CC2)(O)O |
Computed by PubChem (NCBI)