cas: 1256355-49-3 — see every product listed under this CAS number, including other names
(2-(Pyridin-4-ylmethoxy)phenyl)boronic acid 95+% (CAS 1256355-49-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A206271-100mg |
| cas | 1256355-49-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 503.88 Pln | |
| Ambeed | 250mg | 787.56 Pln | |
| Ambeed | 1g | 1905.62 Pln | |
| Ambeed | 5g | 6355.62 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A206271 |
[2-(pyridin-4-ylmethoxy)phenyl]boronic acid (CAS 1256355-49-3) is a chemical compound with the molecular formula C12H12BNO3 and a molecular weight of 229.04 g/mol. IUPAC name: [2-(pyridin-4-ylmethoxy)phenyl]boronic acid. InChIKey: KMRAOKJLIHHQJB-UHFFFAOYSA-N.
| Molecular formula | C12H12BNO3 |
|---|---|
| Molecular weight | 229.04 g/mol |
| IUPAC name | [2-(pyridin-4-ylmethoxy)phenyl]boronic acid |
| InChIKey | KMRAOKJLIHHQJB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1OCC2=CC=NC=C2)(O)O |
Computed by PubChem (NCBI)