cas: 98451-51-5 — see every product listed under this CAS number, including other names
(2-Amino-6-nitrophenyl)methanol 95% (CAS 98451-51-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A751983-100mg |
| cas | 98451-51-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 431.56 Pln | |
| Ambeed | 5g | 1410.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A751983 |
(2-amino-6-nitrophenyl)methanol (CAS 98451-51-5) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: (2-amino-6-nitrophenyl)methanol. InChIKey: BSQXKAWQRQDMAK-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | (2-amino-6-nitrophenyl)methanol |
| InChIKey | BSQXKAWQRQDMAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])CO)N |
Computed by PubChem (NCBI)