cas: 2894-45-3 — see every product listed under this CAS number, including other names
(2-Aminophenyl)(2-chlorophenyl)methanone 95% (CAS 2894-45-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A804437-50mg |
| cas | 2894-45-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 147.88 Pln | |
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 909.94 Pln | |
| Ambeed | 5g | 3346.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A804437 |
(2-aminophenyl)-(2-chlorophenyl)methanone (CAS 2894-45-3) is a chemical compound with the molecular formula C13H10ClNO and a molecular weight of 231.68 g/mol. IUPAC name: (2-aminophenyl)-(2-chlorophenyl)methanone. InChIKey: PKSVTEMCGNQIMD-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | (2-aminophenyl)-(2-chlorophenyl)methanone |
| InChIKey | PKSVTEMCGNQIMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=CC=C2Cl)N |
Computed by PubChem (NCBI)