CAS 2894-45-3 appears in our catalog under these names: (2-Aminophenyl)(2-chlorophenyl)methanone, 95%, (2-Aminophenyl)(2-chlorophenyl)methanone 95%, (2-Aminophenyl)(2-chlorophenyl)methanone, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 50mg, 5g.
(2-aminophenyl)-(2-chlorophenyl)methanone (CAS 2894-45-3) is a chemical compound with the molecular formula C13H10ClNO and a molecular weight of 231.68 g/mol. IUPAC name: (2-aminophenyl)-(2-chlorophenyl)methanone. InChIKey: PKSVTEMCGNQIMD-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | (2-aminophenyl)-(2-chlorophenyl)methanone |
| InChIKey | PKSVTEMCGNQIMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=CC=C2Cl)N |
Computed by PubChem (NCBI)