CAS 122601-80-3 appears in our catalog under these names: (6–Chloropyridin–3–yl)–(4–methylphenyl)methanone, (6-Chloropyridin-3-yl)(p-tolyl)methanone, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
(6-chloro-3-pyridinyl)-(4-methylphenyl)methanone (CAS 122601-80-3) is a chemical compound with the molecular formula C13H10ClNO and a molecular weight of 231.68 g/mol. IUPAC name: (6-chloro-3-pyridinyl)-(4-methylphenyl)methanone. InChIKey: DBWYSTAZFLHSES-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | (6-chloro-3-pyridinyl)-(4-methylphenyl)methanone |
| InChIKey | DBWYSTAZFLHSES-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)