CAS 1020-39-9 appears in our catalog under these names: N-(2-Chlorophenyl)benzamide, 95%, N-(2-Chlorophenyl)benzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg.
N-(2-chlorophenyl)benzamide (CAS 1020-39-9) is a chemical compound with the molecular formula C13H10ClNO and a molecular weight of 231.68 g/mol. IUPAC name: N-(2-chlorophenyl)benzamide. InChIKey: QXZRWUSAQSKAGT-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | N-(2-chlorophenyl)benzamide |
| InChIKey | QXZRWUSAQSKAGT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2Cl |
Computed by PubChem (NCBI)