CAS 6833-15-4 appears in our catalog under these names: 4-Chlorobenzanilide, 4-Chlorobenzanilide, 95%, 4–Chloro–N–phenylbenzamide, 4-Chloro-N-phenylbenzamide, 97%, 97%, p-Chlorobenzanilide, 98%. Offered by: Biosynth, Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 2000mg, 1000mg, 1g, 10g, 5g, 250mg, 100mg.
4-chloro-N-phenylbenzamide (CAS 6833-15-4) is a chemical compound with the molecular formula C13H10ClNO and a molecular weight of 231.68 g/mol. IUPAC name: 4-chloro-N-phenylbenzamide. InChIKey: SFHDVPIEJXCMBP-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | 4-chloro-N-phenylbenzamide |
| InChIKey | SFHDVPIEJXCMBP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)