(2-Bromo-4-methylphenyl)boronic acid, 98%
cas: 854636-01-4 — see every product listed under this CAS number, including other names
(2-Bromo-4-methylphenyl)boronic acid, 98% (CAS 854636-01-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A565068-100mg |
| cas | 854636-01-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 387.06 Pln | |
| Ambeed | 5g | 1410.56 Pln | |
| BLDpharm | 100mg | 219.95 Pln | |
| BLDpharm | 250mg | 319.91 Pln | |
| BLDpharm | 1g | 414.32 Pln | |
| BLDpharm | 5g | 1513.94 Pln | |
| Chemat | 100mg | 141.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2-bromo-4-methylphenyl)boronic acid (CAS 854636-01-4) is a chemical compound with the molecular formula C7H8BBrO2 and a molecular weight of 214.85 g/mol. IUPAC name: (2-bromo-4-methylphenyl)boronic acid. InChIKey: PWIXPRHFXJQBJS-UHFFFAOYSA-N.
| Molecular formula | C7H8BBrO2 |
|---|---|
| Molecular weight | 214.85 g/mol |
| IUPAC name | (2-bromo-4-methylphenyl)boronic acid |
| InChIKey | PWIXPRHFXJQBJS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C)Br)(O)O |
Computed by PubChem (NCBI)
