Products 849062-36-8
CAS 849062-36-8 appears in our catalog under these names: 3-Bromo-5-methylphenylboronic acid, 97%, 3-Bromo-5-methylphenylboronic acid, >95% (HPLC), 3-Bromo-5-methylphenylboronic acid, (3-Bromo-5-methylphenyl)boronic acid 97%, (3-Bromo-5-methylphenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 100mg, 50g.
(3-bromo-5-methylphenyl)boronic acid (CAS 849062-36-8) is a chemical compound with the molecular formula C7H8BBrO2 and a molecular weight of 214.85 g/mol. IUPAC name: (3-bromo-5-methylphenyl)boronic acid. InChIKey: KKEPYOBFWSGWLQ-UHFFFAOYSA-N.
| Molecular formula | C7H8BBrO2 |
|---|---|
| Molecular weight | 214.85 g/mol |
| IUPAC name | (3-bromo-5-methylphenyl)boronic acid |
| InChIKey | KKEPYOBFWSGWLQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)C)(O)O |
Computed by PubChem (NCBI)