CAS 2304635-39-8 appears in our catalog under these names: 2-Bromo-3-methylphenylboronic acid, 95%, 2-Bromo-3-methylphenylboronic acid, 98%, 98%, (2-BROMO-3-METHYLPHENYL)BORONIC ACID, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
(2-bromo-3-methylphenyl)boronic acid (CAS 2304635-39-8) is a chemical compound with the molecular formula C7H8BBrO2 and a molecular weight of 214.85 g/mol. IUPAC name: (2-bromo-3-methylphenyl)boronic acid. InChIKey: BWUUIUQTUYDPNF-UHFFFAOYSA-N.
| Molecular formula | C7H8BBrO2 |
|---|---|
| Molecular weight | 214.85 g/mol |
| IUPAC name | (2-bromo-3-methylphenyl)boronic acid |
| InChIKey | BWUUIUQTUYDPNF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C)Br)(O)O |
Computed by PubChem (NCBI)