CAS 221006-71-9 appears in our catalog under these names: 4–Bromo–2–methylphenylboronic acid, (4-Bromo-2-methylphenyl)boronic acid, 97%, 97%, (4-Bromo-2-methylphenyl)boronic acid, 95%, (4-Bromo-2-methylphenyl)boronic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 100g, 100mg, 250mg, 5g, 25g.
(4-bromo-2-methylphenyl)boronic acid (CAS 221006-71-9) is a chemical compound with the molecular formula C7H8BBrO2 and a molecular weight of 214.85 g/mol. IUPAC name: (4-bromo-2-methylphenyl)boronic acid. InChIKey: BEQUDVVISBTSHZ-UHFFFAOYSA-N.
| Molecular formula | C7H8BBrO2 |
|---|---|
| Molecular weight | 214.85 g/mol |
| IUPAC name | (4-bromo-2-methylphenyl)boronic acid |
| InChIKey | BEQUDVVISBTSHZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Br)C)(O)O |
Computed by PubChem (NCBI)