Products 854636-01-4
CAS 854636-01-4 appears in our catalog under these names: 2-BROMO-4-METHYLPHENYLBORONIC ACID, 98%, (2-bromo-4-methylphenyl)boronic acid, 97%, (2-Bromo-4-methylphenyl)boronic acid 98%, (2-Bromo-4-methylphenyl)boronic acid, 98%, 98%. Offered by: Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 100mg, 250mg.
(2-bromo-4-methylphenyl)boronic acid (CAS 854636-01-4) is a chemical compound with the molecular formula C7H8BBrO2 and a molecular weight of 214.85 g/mol. IUPAC name: (2-bromo-4-methylphenyl)boronic acid. InChIKey: PWIXPRHFXJQBJS-UHFFFAOYSA-N.
| Molecular formula | C7H8BBrO2 |
|---|---|
| Molecular weight | 214.85 g/mol |
| IUPAC name | (2-bromo-4-methylphenyl)boronic acid |
| InChIKey | PWIXPRHFXJQBJS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C)Br)(O)O |
Computed by PubChem (NCBI)