cas: 869725-53-1 — see every product listed under this CAS number, including other names
(2-Bromo-5-(trifluoromethyl)phenyl)methanol, 97%, 97% (CAS 869725-53-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119E7Z-250mg |
| cas | 869725-53-1 |
| size | 250mg |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 309.20 Pln | |
| Chemat | 25g | 674.00 Pln | |
| Chemat | 100g | 1792.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[2-bromo-5-(trifluoromethyl)phenyl]methanol (CAS 869725-53-1) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: [2-bromo-5-(trifluoromethyl)phenyl]methanol. InChIKey: RXASTJJSPATSHH-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | [2-bromo-5-(trifluoromethyl)phenyl]methanol |
| InChIKey | RXASTJJSPATSHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CO)Br |
Computed by PubChem (NCBI)