cas: 869725-53-1 — see every product listed under this CAS number, including other names
2-Bromo-5-(trifluoromethyl)benzyl alcohol, 97% (CAS 869725-53-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F013791-1G |
| cas | 869725-53-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 190.58 Pln | |
| Fluorochem | 10g | 315.53 Pln | |
| Fluorochem | 25g | 575.86 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
[2-bromo-5-(trifluoromethyl)phenyl]methanol (CAS 869725-53-1) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: [2-bromo-5-(trifluoromethyl)phenyl]methanol. InChIKey: RXASTJJSPATSHH-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | [2-bromo-5-(trifluoromethyl)phenyl]methanol |
| InChIKey | RXASTJJSPATSHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CO)Br |
Computed by PubChem (NCBI)