(2-Bromo-5-fluorophenyl)boronic acid, 98%
cas: 959996-48-6 — see every product listed under this CAS number, including other names
(2-Bromo-5-fluorophenyl)boronic acid, 98% (CAS 959996-48-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g. Offered by: BLDpharm, Chemat, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD7999-250mg |
| cas | 959996-48-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 250mg | 169.96 Pln | |
| BLDpharm | 1g | 208.84 Pln | |
| BLDpharm | 5g | 492.07 Pln | |
| BLDpharm | 25g | 1730.53 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 352.40 Pln | |
| Chemat | 10g | 626.00 Pln | |
| Chemat | 25g | 1437.20 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 476.93 Pln | |
| Fluorochem | 25g | 1351.62 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2-bromo-5-fluorophenyl)boronic acid (CAS 959996-48-6) is a chemical compound with the molecular formula C6H5BBrFO2 and a molecular weight of 218.82 g/mol. IUPAC name: (2-bromo-5-fluorophenyl)boronic acid. InChIKey: NBWMJVDWOGDXIQ-UHFFFAOYSA-N.
| Molecular formula | C6H5BBrFO2 |
|---|---|
| Molecular weight | 218.82 g/mol |
| IUPAC name | (2-bromo-5-fluorophenyl)boronic acid |
| InChIKey | NBWMJVDWOGDXIQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)Br)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Bromo-5-fluorobenzeneboronic acid, 2-Bromo-5-fluorophenylboronic acid, (2-Bromo-5-fluorophenyl)boronic acid, (2-Bromo-5-fluoro-phenyl)boronic acid, NBWMJVDWOGDXIQ-UHFFFAOYSA-N, 2-Bromo-5-fluorophenylboronic com, (2-Bromo-5-fluorophenyl)boronicacid, 2-Bromo-5-fluorobenzeneboronic acid, 97%