cas: 603122-80-1 — see every product listed under this CAS number, including other names
(2-Chloro-4-(methoxycarbonyl)phenyl)boronic acid, 97%, 97% (CAS 603122-80-1) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EB52-50g |
| cas | 603122-80-1 |
| size | 50g |
| availability | 1500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 1278.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 309.20 Pln | |
| Chemat | 25g | 674.00 Pln | |
| Chemat | 100g | 2488.40 Pln | |
| Chemat | 500g | 10262.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2-chloro-4-methoxycarbonylphenyl)boronic acid (CAS 603122-80-1) is a chemical compound with the molecular formula C8H8BClO4 and a molecular weight of 214.41 g/mol. IUPAC name: (2-chloro-4-methoxycarbonylphenyl)boronic acid. InChIKey: ITEQHBSWRMYSRP-UHFFFAOYSA-N.
| Molecular formula | C8H8BClO4 |
|---|---|
| Molecular weight | 214.41 g/mol |
| IUPAC name | (2-chloro-4-methoxycarbonylphenyl)boronic acid |
| InChIKey | ITEQHBSWRMYSRP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OC)Cl)(O)O |
Computed by PubChem (NCBI)