CAS 913835-92-4 appears in our catalog under these names: (2–Chloro–5–(methoxycarbonyl)phenyl)boronic acid, 2-Chloro-5-(methoxycarbonyl)phenylboronic acid, 97%. Offered by: GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
(2-chloro-5-methoxycarbonylphenyl)boronic acid (CAS 913835-92-4) is a chemical compound with the molecular formula C8H8BClO4 and a molecular weight of 214.41 g/mol. IUPAC name: (2-chloro-5-methoxycarbonylphenyl)boronic acid. InChIKey: LZMDHZSRUQKDFI-UHFFFAOYSA-N.
| Molecular formula | C8H8BClO4 |
|---|---|
| Molecular weight | 214.41 g/mol |
| IUPAC name | (2-chloro-5-methoxycarbonylphenyl)boronic acid |
| InChIKey | LZMDHZSRUQKDFI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)OC)Cl)(O)O |
Computed by PubChem (NCBI)