CAS 957120-26-2 appears in our catalog under these names: (3–Chloro–5–(methoxycarbonyl)phenyl)boronic acid, (3-Chloro-5-(methoxycarbonyl)phenyl)boronic acid, (3-Chloro-5-(methoxycarbonyl)phenyl)boronic acid, 97%. Offered by: GLPBio, Biosynth, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
(3-chloro-5-methoxycarbonylphenyl)boronic acid (CAS 957120-26-2) is a chemical compound with the molecular formula C8H8BClO4 and a molecular weight of 214.41 g/mol. IUPAC name: (3-chloro-5-methoxycarbonylphenyl)boronic acid. InChIKey: XRIPARKZRWXMTC-UHFFFAOYSA-N.
| Molecular formula | C8H8BClO4 |
|---|---|
| Molecular weight | 214.41 g/mol |
| IUPAC name | (3-chloro-5-methoxycarbonylphenyl)boronic acid |
| InChIKey | XRIPARKZRWXMTC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Cl)C(=O)OC)(O)O |
Computed by PubChem (NCBI)