CAS 511295-08-2 is the registry number for (3-Chloro-5-formyl-2-methoxyphenyl)boronic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g.
(3-chloro-5-formyl-2-methoxyphenyl)boronic acid (CAS 511295-08-2) is a chemical compound with the molecular formula C8H8BClO4 and a molecular weight of 214.41 g/mol. IUPAC name: (3-chloro-5-formyl-2-methoxyphenyl)boronic acid. InChIKey: QRKBAGJAJIEBRJ-UHFFFAOYSA-N.
| Molecular formula | C8H8BClO4 |
|---|---|
| Molecular weight | 214.41 g/mol |
| IUPAC name | (3-chloro-5-formyl-2-methoxyphenyl)boronic acid |
| InChIKey | QRKBAGJAJIEBRJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC)Cl)C=O)(O)O |
Computed by PubChem (NCBI)