cas: 77008-58-3 — see every product listed under this CAS number, including other names
(2-Chlorophenyl)(3-chlorophenyl)methanone 95+% (CAS 77008-58-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A461892-250mg |
| cas | 77008-58-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 804.25 Pln | |
| Ambeed | 10g | 1410.56 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A461892 |
(2-chlorophenyl)-(3-chlorophenyl)methanone (CAS 77008-58-3) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: (2-chlorophenyl)-(3-chlorophenyl)methanone. InChIKey: ZOEYPNHFGDABED-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | (2-chlorophenyl)-(3-chlorophenyl)methanone |
| InChIKey | ZOEYPNHFGDABED-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)