cas: 77008-58-3 — see every product listed under this CAS number, including other names
(2-Chlorophenyl)(3-chlorophenyl)methanone, 95+%, 95+% (CAS 77008-58-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116EQE-250mg |
| cas | 77008-58-3 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 333.20 Pln | |
| Chemat | 5g | 914.00 Pln | |
| Chemat | 10g | 1422.80 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
(2-chlorophenyl)-(3-chlorophenyl)methanone (CAS 77008-58-3) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: (2-chlorophenyl)-(3-chlorophenyl)methanone. InChIKey: ZOEYPNHFGDABED-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | (2-chlorophenyl)-(3-chlorophenyl)methanone |
| InChIKey | ZOEYPNHFGDABED-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)