cas: 1260518-74-8 — see every product listed under this CAS number, including other names
(2-Ethoxy-4-(trifluoromethyl)phenyl)boronic acid 98% (CAS 1260518-74-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A424056-100mg |
| cas | 1260518-74-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 542.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A424056 |
[2-ethoxy-4-(trifluoromethyl)phenyl]boronic acid (CAS 1260518-74-8) is a chemical compound with the molecular formula C9H10BF3O3 and a molecular weight of 233.98 g/mol. IUPAC name: [2-ethoxy-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: LWIPWPSKZPQBCK-UHFFFAOYSA-N.
| Molecular formula | C9H10BF3O3 |
|---|---|
| Molecular weight | 233.98 g/mol |
| IUPAC name | [2-ethoxy-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | LWIPWPSKZPQBCK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(F)(F)F)OCC)(O)O |
Computed by PubChem (NCBI)