Products 864301-27-9
CAS 864301-27-9 appears in our catalog under these names: 2–Ethoxy–5–fluorophenylboronic acid(contains varying amounts of Anhydride), 2-Ethoxy-5-fluorophenylboronic acid, 98%, 98%, (2-Ethoxy-5-fluorophenyl)boronic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g.
(2-ethoxy-5-fluorophenyl)boronic acid (CAS 864301-27-9) is a chemical compound with the molecular formula C8H10BFO3 and a molecular weight of 183.97 g/mol. IUPAC name: (2-ethoxy-5-fluorophenyl)boronic acid. InChIKey: LOVFKIWGXGWXLN-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO3 |
|---|---|
| Molecular weight | 183.97 g/mol |
| IUPAC name | (2-ethoxy-5-fluorophenyl)boronic acid |
| InChIKey | LOVFKIWGXGWXLN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)OCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2-Ethoxy-5-fluorophenyl)boronic acid, 2-Ethoxy-5-fluorophenylboronic acid, (2-Ethoxy-5-fluorophenyl)boronicacid, (2-Ethoxy-5-fluoro-phenyl)boronic acid, 5-fluoro-2-ethoxyphenyl b, 5-fluoro-2-ethoxyphenyl boronic acid, 2-ethoxy-5-fluoro-phenyl-boronic acid, 2-Ethoxy-5-fluorophenylboronic acid(contains varying amounts of Anhydride)