Products 2096329-52-9
CAS 2096329-52-9 appears in our catalog under these names: 2-Fluoro-3-methoxy-5-methylphenylboronic acid, 98%, (2-Fluoro-3-methoxy-5-methylphenyl)boronic acid, 97%, 2-Fluoro-3-methoxy-5-methylphenylboronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 10g, 1g, 25g.
(2-fluoro-3-methoxy-5-methylphenyl)boronic acid (CAS 2096329-52-9) is a chemical compound with the molecular formula C8H10BFO3 and a molecular weight of 183.97 g/mol. IUPAC name: (2-fluoro-3-methoxy-5-methylphenyl)boronic acid. InChIKey: OTXTXRTWSHJYDV-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO3 |
|---|---|
| Molecular weight | 183.97 g/mol |
| IUPAC name | (2-fluoro-3-methoxy-5-methylphenyl)boronic acid |
| InChIKey | OTXTXRTWSHJYDV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)OC)C)(O)O |
Computed by PubChem (NCBI)