Products 337536-19-3
CAS 337536-19-3 appears in our catalog under these names: 4–Fluoro–3–(methoxymethyl)phenylboronic acid, 4-Fluoro-3-(methoxymethyl)phenylboronic acid, 4-Fluoro-3-(methoxymethyl)phenylboronic acid, 95%, (4-fluoro-3-(methoxymethyl)phenyl)boronic acid, 95+%, 4-fluoro-3-(methoxymethyl)phenylboronic acid, 95%, 95%. Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg.
[4-fluoro-3-(methoxymethyl)phenyl]boronic acid (CAS 337536-19-3) is a chemical compound with the molecular formula C8H10BFO3 and a molecular weight of 183.97 g/mol. IUPAC name: [4-fluoro-3-(methoxymethyl)phenyl]boronic acid. InChIKey: APSMSGBDXRJPKJ-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO3 |
|---|---|
| Molecular weight | 183.97 g/mol |
| IUPAC name | [4-fluoro-3-(methoxymethyl)phenyl]boronic acid |
| InChIKey | APSMSGBDXRJPKJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)COC)(O)O |
Computed by PubChem (NCBI)